CymitQuimica logo

CAS 100289-21-2

:

1-(2-Methylimidazo[1,2-a]pyrimidin-3-yl)ethanone

Description:
1-(2-Methylimidazo[1,2-a]pyrimidin-3-yl)ethanone, with the CAS number 100289-21-2, is a heterocyclic organic compound characterized by its complex structure that includes both imidazole and pyrimidine rings. This compound typically exhibits a molecular formula that reflects its heteroatom content and structural features, contributing to its unique chemical properties. It is known for its potential biological activity, particularly in the context of mutagenicity and carcinogenicity, often studied in relation to food safety and toxicology. The presence of the methyl group and the ethanone functional group influences its reactivity and interaction with biological systems. Additionally, this compound may exhibit solubility in organic solvents, which is common for many heterocyclic compounds, and its stability can vary depending on environmental conditions. Overall, 1-(2-Methylimidazo[1,2-a]pyrimidin-3-yl)ethanone serves as a significant subject of research in both synthetic organic chemistry and pharmacology due to its intriguing structural characteristics and potential implications in health sciences.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c1-6-8(7(2)13)12-5-3-4-10-9(12)11-6/h3-5H,1-2H3
InChI key:InChIKey=NCBHHBZOTLBPLZ-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1N2C(=NC1C)N=CC=C2
Synonyms:
  • Imidazo[1,2-a]pyrimidine, ethanone deriv.
  • Ethanone, 1-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-
  • 1-[2-Methylimidazo[1,2-a]pyrimidin-3-yl]ethan-1-one
  • 1-(2-Methylimidazo[1,2-a]pyrimidin-3-yl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.