CAS 1003-18-5
:1-Chloro-2-phospholene 1-oxide
Description:
1-Chloro-2-phospholene 1-oxide is a chemical compound characterized by its unique structure, which includes a phospholene ring with a chlorine substituent and an oxide functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the chlorine atom. The phospholene ring contributes to its stability and potential applications in organic synthesis, particularly in the development of phosphorous-containing compounds. It is also recognized for its role as a reagent in various chemical transformations. The presence of the oxide group enhances its electrophilic character, making it useful in certain catalytic processes. Safety precautions are necessary when handling this compound, as it may pose health risks through inhalation or skin contact. Overall, 1-Chloro-2-phospholene 1-oxide is a valuable compound in the field of synthetic organic chemistry, particularly in the synthesis of phosphorous derivatives and other functionalized organic molecules.
Formula:C4H6ClOP
InChI:InChI=1S/C4H6ClOP/c5-7(6)3-1-2-4-7/h1,3H,2,4H2
InChI key:InChIKey=HUSTZVJBPMIGEX-UHFFFAOYSA-N
SMILES:ClP1(=O)CCC=C1
Synonyms:- 1-Chloro-2-phospholene 1-oxide
- 2-Phospholene, 1-chloro-, 1-oxide
- 1-Chloro-2-phospholene oxide
- 1H-Phosphole, 1-chloro-2,3-dihydro-, 1-oxide
- 1-Chloro-1-oxo-Δ2-phospholene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
