CAS 1003-38-9: 2,5-Dimethyltetrahydrofuran
Description:2,5-Dimethyltetrahydrofuran (CAS 1003-38-9) is a cyclic ether with a five-membered ring structure that contains two methyl groups at the 2 and 5 positions. This compound is a colorless liquid at room temperature and exhibits a pleasant, sweet odor. It is known for its good solubility in organic solvents and moderate polarity, making it useful as a solvent in various chemical reactions and processes. The presence of the tetrahydrofuran ring contributes to its relatively low viscosity and volatility compared to other solvents. 2,5-Dimethyltetrahydrofuran is stable under normal conditions but can undergo reactions typical of ethers, such as cleavage in the presence of strong acids. Its unique structure allows it to participate in various chemical transformations, including polymerization and as a reagent in organic synthesis. Additionally, it has garnered interest as a potential biofuel and solvent due to its renewable production from biomass. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon inhalation or skin contact.
Formula:C6H12O
InChI:InChI=1S/C6H12O/c1-5-3-4-6(2)7-5/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=OXMIDRBAFOEOQT-UHFFFAOYSA-N
SMILES:O1C(C)CCC1C
- Synonyms:
- Furan, tetrahydro-2,5-dimethyl-
- 2,5-Dimethyltetrahydrofuran
- 2,5-Dimethyloxolane
- Tetrahydro-2,5-dimethylfuran
- NSC 12594
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2,5-Dimethyltetrahydrofuran (stabilized with BHT)
Ref: 3B-D1948
25ml | 137.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Furan, tetrahydro-2,5-dimethyl-
Ref: IN-DA0001IO
5g | 170.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2,5-Dimethyltetrahydrofuran
Ref: 54-OR928860
1ml | 39.00 € | ||
5ml | 89.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2,5-Dimethyltetrahydrofuran (stabilized with BHT)
- Ethers
- 5-membered Heterocycles
- Furan
- Tetrahydrofuran
- See more categories
- Ether and Impurities
Ref: 10-F242806
5g | To inquire | ||
25ml | 277.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2,5-Dimethyltetrahydrofuran
Ref: 3D-FD166226
Undefined size | Discontinued | Request information |