CAS 1003-50-5

4,5-Dibromo-1-methyl-1H-imidazole

Description:

4,5-Dibromo-1-methyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which contains two bromine substituents at the 4 and 5 positions and a methyl group at the 1 position. This compound typically appears as a white to light yellow solid and is soluble in polar organic solvents. Its molecular structure contributes to its reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromine atoms, which are good leaving groups. The imidazole ring is known for its role in biological systems, particularly in the structure of amino acids and nucleotides. 4,5-Dibromo-1-methyl-1H-imidazole may exhibit antimicrobial properties and is of interest in various fields, including pharmaceuticals and agrochemicals. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.

Formula: C₄H₄Br₂N₂

InChI: InChI=1/C4H4Br2N2/c1-8-2-7-3(5)4(8)6/h2H,1H3

SMILES: Cn1cnc(c1Br)Br

1H-Imidazole, 4,5-dibromo-1-methyl-

CAS: 1003-50-5

Formula: C₄H₄Br₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.8960

Ref: IN-DA0001II

4,5-Dibromo-1-methyl-1H-imidazole

CAS: 1003-50-5

4,5-Dibromo-1-methyl-1H-imidazole

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.90g/mol

Ref: 54-OR10436

4,5-Dibromo-1-methyl-1H-imidazole

CAS: 1003-50-5

Formula: C₄H₄Br₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.898

Ref: 10-F211700