CAS 1003-55-0
:3,4-Dihydro-N,N-dimethyl-2H-pyrrol-5-amine
Description:
3,4-Dihydro-N,N-dimethyl-2H-pyrrol-5-amine, with the CAS number 1003-55-0, is an organic compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits basic properties due to the presence of the amine functional group, making it capable of forming salts with acids. The dimethyl substitution on the nitrogen atom contributes to its steric hindrance and influences its reactivity and interaction with other chemical species. This compound is often studied for its potential applications in pharmaceuticals and organic synthesis, particularly as a building block in the development of various biologically active molecules. Its solubility in polar solvents and moderate volatility are also notable characteristics, which can affect its handling and storage. As with many nitrogen-containing compounds, it may have implications for biological activity, warranting further investigation in medicinal chemistry contexts.
Formula:C6H12N2
InChI:InChI=1S/C6H12N2/c1-8(2)6-4-3-5-7-6/h3-5H2,1-2H3
InChI key:InChIKey=PRQMIJVEENXPNQ-UHFFFAOYSA-N
SMILES:N(C)(C)C=1CCCN1
Synonyms:- 2-(Dimethylamino)-1-pyrroline
- 2H-Pyrrol-5-amine, 3,4-dihydro-N,N-dimethyl-
- 1-Pyrroline, 2-(dimethylamino)-
- 3,4-Dihydro-N,N-dimethyl-2H-pyrrol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
