
CAS 1003-78-7
:2,4-Dimethylsulfolane
Description:
2,4-Dimethylsulfolane, with the CAS number 1003-78-7, is a sulfolane derivative characterized by its unique chemical structure, which includes a sulfone functional group. This compound is a colorless to pale yellow liquid at room temperature and is known for its high polarity and excellent solvent properties, making it useful in various chemical processes and applications. It has a relatively high boiling point, which allows it to remain stable under elevated temperatures. 2,4-Dimethylsulfolane is soluble in water and many organic solvents, enhancing its versatility in laboratory and industrial settings. Additionally, it exhibits low volatility, which contributes to its effectiveness as a solvent in reactions that require prolonged heating. The presence of methyl groups in its structure can influence its reactivity and interaction with other substances. Safety data indicates that while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to mitigate any potential risks associated with its use.
Formula:C6H12O2S
InChI:InChI=1S/C6H12O2S/c1-5-3-6(2)9(7,8)4-5/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=WKFQMDFSDQFAIC-UHFFFAOYSA-N
SMILES:O=S1(=O)C(C)CC(C)C1
Synonyms:- 2,4-Dimethyl-tetrahydro-thiophene 1,1-dioxide
- 2,4-Dimethyltetramethylene sulfone
- Thiophene, tetrahydro-2,4-dimethyl-, 1,1-dioxide
- 2,4-Dimethylsulfolane
- NSC 60703
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
