CAS 100307-95-7
:2-aminobenzoylalanyl-glycyl-leucyl-alanyl-4-nitrobenzylamide
Description:
2-Aminobenzoylalanyl-glycyl-leucyl-alanyl-4-nitrobenzylamide is a synthetic peptide compound characterized by its complex structure, which includes an amino acid sequence and a nitrobenzylamide moiety. This compound features a combination of amino acids, specifically alanine, glycine, and leucine, linked through peptide bonds, contributing to its biological activity and potential applications in medicinal chemistry. The presence of the 4-nitrobenzyl group introduces a nitro functional group, which can influence the compound's reactivity and solubility. The amino group in the benzoyl moiety enhances its potential for interactions with biological targets, making it of interest in drug design and development. The compound's properties, such as solubility, stability, and biological activity, can vary based on its structural components and the specific arrangement of the amino acids. Overall, 2-aminobenzoylalanyl-glycyl-leucyl-alanyl-4-nitrobenzylamide represents a class of compounds that may exhibit unique pharmacological properties, warranting further investigation in biochemical and pharmaceutical research.
Formula:C28H37N7O7
InChI:InChI=1/C28H37N7O7/c1-16(2)13-23(33-24(36)14-31-25(37)17(3)29)26(38)32-18(4)27(39)34(28(40)21-7-5-6-8-22(21)30)15-19-9-11-20(12-10-19)35(41)42/h5-12,16-18,23H,13-15,29-30H2,1-4H3,(H,31,37)(H,32,38)(H,33,36)/t17-,18-,23-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](C)C(=O)N(Cc1ccc(cc1)N(=O)=O)C(=O)c1ccccc1N)O)N=C(CN=C([C@H](C)N)O)O
Synonyms:- 2-Aminobenzoyl-ala-gly-leu-ala-4-nitrobenzylamide
- Aaglan
- Abz-ala-gly-leu-ala-nba
- L-Alaninamide, N-(2-aminobenzoyl)-L-alanylglycyl-L-leucyl-N-((4-nitrophenyl)methyl)-, (6aS-(6aalpha,7alpha,8beta,9aalpha))-
- L-alanylglycyl-L-leucyl-N-[(2-aminophenyl)carbonyl]-N-(4-nitrobenzyl)-L-alaninamide
- 2-Aminobenzoylalanyl-glycyl-leucyl-alanyl-4-nitrobenzylamide
- 2-Aminobenzoyl-Ala-Gly-Leu-Ala-p-nitrobenzylamide
- L-Alaninamide, N-(2-aminobenzoyl)-L-alanylglycyl-L-leucyl-N-[(4-nitrophenyl)methyl]-
- 2-amino-N-[(2S)-1-[[2-[[(2S)-4-methyl-1-[[(2S)-2-[(4-nitrophenyl)methylamino]propanoyl]amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]benzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Abz-Ala-Gly-Leu-Ala-p-nitrobenzylamide
CAS:A fluorogenic substrate for neutral metalloendopeptidases, e.g. Pseudomonas aeruginosa elastase, enkephalinase (NEP 24.11), and thermolysin. Abz-AGLA-Nba is also cleaved by atrolysin B and C.Formula:C28H37N7O7Purity:96.2%Color and Shape:YellowMolecular weight:583.65Abz-Ala-Gly-Leu-Ala-p-Nitro-Benzyl-Amide
CAS:Abz-Ala-Gly-Leu-Ala-p-Nitro-Benzyl-Amide is an enzyme inhibitor that is used to treat cancer. It is a potent and selective inhibitor of neutral endopeptidase, which is an enzyme involved in the process of inflammation. Abz-Ala-Gly-Leu-Ala-p-Nitro-Benzyl Amide can be used to inhibit the interaction between gram negative bacteria and human cells, and has been shown to have antimicrobial properties against Pseudomonas aeruginosa. This compound may also be able to modulate metalloendopeptidases, which are resistant to endopeptidases.
Formula:C28H37N7O7Purity:Min. 95%Molecular weight:583.64 g/molAbz-Ala-Gly-Leu-Ala-p-nitrobenzylamide
CAS:Benzamidine is a benzamidase inhibitor that competitively binds to bacterial enzymes such as metalloendopeptidases and matrix metalloproteinases. It inhibits the degradation of collagen, resulting in a higher concentration of soluble extract. This drug also has an effect on spermatozoa, which may be due to its ability to inhibit bacterial enzymes that are involved with uptake and preload. Benzamidine has been shown to have a pH optimum of 8-9 and is most active at this pH range.Formula:C28H37N7O7Purity:Min. 95%Molecular weight:583.64 g/mol

