CymitQuimica logo

CAS 100307-96-8

:

Prosta-4,13-dien-1-oic acid, 5,9-epoxy-11,15-dihydroxy-, (4Z,9α,11α,13E,15S)-

Description:
Prosta-4,13-dien-1-oic acid, 5,9-epoxy-11,15-dihydroxy-, (4Z,9α,11α,13E,15S)-, with CAS number 100307-96-8, is a complex organic compound belonging to the class of prostaglandins, which are bioactive lipids involved in various physiological processes. This substance features multiple functional groups, including hydroxyl (-OH) groups and an epoxy group, contributing to its reactivity and biological activity. The presence of double bonds in its structure indicates unsaturation, which is typical for prostaglandins, allowing for various conformations and interactions with biological targets. Its stereochemistry, denoted by the specific configuration at various carbon centers, is crucial for its biological function, influencing how it interacts with receptors and enzymes in the body. Prostaglandins are known for their roles in inflammation, pain modulation, and regulation of various physiological functions, making this compound potentially significant in pharmacological and therapeutic contexts. Overall, its unique structural features and stereochemistry are key to its biological activity and potential applications in medicine.
Formula:C20H32O5
InChI:InChI=1S/C20H32O5/c1-2-3-4-6-14(21)9-11-16-17-12-10-15(7-5-8-20(23)24)25-19(17)13-18(16)22/h7,9,11,14,16-19,21-22H,2-6,8,10,12-13H2,1H3,(H,23,24)/b11-9+,15-7-/t14-,16+,17+,18+,19-/m0/s1
InChI key:InChIKey=PUQDBCHQWPJZPM-SSZOLWNYSA-N
SMILES:C(=C/[C@H](CCCCC)O)\[C@@H]1[C@@]2([C@@](O/C(=C\CCC(O)=O)/CC2)(C[C@H]1O)[H])[H]
Synonyms:
  • Prosta-4,13-dien-1-oic acid, 5,9-epoxy-11,15-dihydroxy-, (4Z,9α,11α,13E,15S)-
  • Cyclopenta[b]pyran, prosta-4,13-dien-1-oic acid deriv.
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.