CAS 10031-21-7
:Bromic acid, lead(2+) salt, monohydrate
Description:
Bromic acid, lead(2+) salt, monohydrate, with the CAS number 10031-21-7, is an inorganic compound that consists of lead ions combined with bromate ions and water of hydration. This substance typically appears as a crystalline solid and is characterized by its relatively high density and solubility in water, which can vary based on temperature and concentration. The presence of lead ions indicates potential toxicity, as lead compounds are known to pose health risks, particularly through ingestion or inhalation. The monohydrate form suggests that each formula unit of the compound is associated with one molecule of water, which can influence its stability and reactivity. In terms of chemical behavior, bromic acid salts can act as oxidizing agents, and the compound may participate in various chemical reactions, including those involving halogenated species. Proper handling and disposal are crucial due to the toxic nature of lead and the potential environmental impact of bromate ions.
Formula:BrHO3H2OPb
InChI:InChI=1S/BrHO3.H2O.Pb/c2-1(3)4;;/h(H,2,3,4);1H2;
InChI key:InChIKey=HCFQJACQTPIESR-UHFFFAOYSA-N
SMILES:Br(=O)(=O)O.O.[Pb]
Synonyms:- Lead bromate monohydrate
- Bromic acid, lead(2+) salt, monohydrate
- Lead bromate (Pb(BrO3)2) monohydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
