CAS 10031-86-4
:1-Phenylpropyl butanoate
Description:
1-Phenylpropyl butanoate, with the CAS number 10031-86-4, is an ester formed from the reaction of butanoic acid and 1-phenylpropanol. This compound typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor, characteristic of many esters. It is generally soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The molecular structure features a butanoate group attached to a phenylpropyl moiety, which contributes to its unique properties. 1-Phenylpropyl butanoate is often used in the fragrance and flavor industry, as well as in various chemical syntheses. Its stability under normal conditions makes it suitable for various applications, although it should be handled with care due to potential irritant properties. As with many esters, it may undergo hydrolysis in the presence of water, especially under acidic or basic conditions, leading to the release of the corresponding alcohol and acid.
Formula:C13H18O2
InChI:InChI=1S/C13H18O2/c1-3-8-13(14)15-12(4-2)11-9-6-5-7-10-11/h5-7,9-10,12H,3-4,8H2,1-2H3
InChI key:InChIKey=SNUDRKNHOSAKGS-UHFFFAOYSA-N
SMILES:C(OC(CCC)=O)(CC)C1=CC=CC=C1
Synonyms:- Butanoic acid, 1-phenylpropyl ester
- α-Ethylbenzyl butyrate
- 1-Phenylpropyl butanoate
- Butyric acid, α-ethylbenzyl ester
- 1-Phenylpropyl butyrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
