CAS 10031-88-6
:2-Ethyl-2-heptenal
Description:
2-Ethyl-2-heptenal is an organic compound classified as an aldehyde, characterized by its long carbon chain and the presence of a terminal carbonyl group. It features a seven-carbon backbone with an ethyl group attached to the second carbon, contributing to its unique structure and properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often described as fruity or floral. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 2-Ethyl-2-heptenal is known for its reactivity, particularly in undergoing oxidation and condensation reactions, which makes it useful in various synthetic applications, including the production of flavoring agents and fragrances. Additionally, it may serve as an intermediate in organic synthesis. Safety data indicates that, like many aldehydes, it should be handled with care due to potential irritant properties and the need for proper ventilation during use.
Formula:C9H16O
InChI:InChI=1S/C9H16O/c1-3-5-6-7-9(4-2)8-10/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=RKQKOUYEJBHOFR-UHFFFAOYSA-N
SMILES:C(=CCCCC)(CC)C=O
Synonyms:- 2-Ethyl-2-hepten-1-al
- 2-Ethyl-2-heptenal
- 2-Heptenal, 2-ethyl-
- 2-Ethyl-3-butylacrolein
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
