CAS 100310-87-0
:1,3-BENZODIOXOLE, 2-(2-(2-(DIETHYLAMINO)ETHOXY)ETHYL)-2,5-DIMETHYL-, C ITRATE
Description:
1,3-Benzodioxole, 2-(2-(2-(diethylamino)ethoxy)ethyl)-2,5-dimethyl-, citrate, identified by CAS number 100310-87-0, is a complex organic compound characterized by its unique structural features. It contains a benzodioxole moiety, which contributes to its aromatic properties, and a diethylamino group that enhances its solubility and potential biological activity. The presence of multiple ethoxy and methyl groups suggests that the compound may exhibit significant steric hindrance, influencing its reactivity and interaction with biological systems. As a citrate derivative, it may also possess properties related to citrate metabolism, potentially impacting its pharmacological profile. This compound is likely to be of interest in medicinal chemistry and pharmacology, particularly for its potential applications in drug development. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, as well as its biological activity, would require further investigation through experimental studies or literature review.
Formula:C23H35NO10
InChI:InChI=1/C17H27NO3.C6H8O7/c1-5-18(6-2)10-12-19-11-9-17(4)20-15-8-7-14(3)13-16(15)21-17;7-2-6(4(10)11,5(12)13)1-3(8)9/h7-8,13H,5-6,9-12H2,1-4H3;7H,1-2H2,(H,8,9)(H,10,11)(H,12,13)
Synonyms:- 1,3-Benzodioxole, 2-(2-(2-(diethylamino)ethoxy)ethyl)-2,5-dimethyl-, citrate
- 2-[2-(2,5-dimethyl-1,3-benzodioxol-2-yl)ethoxy]-N,N-diethylethanaminium 2,3-dicarboxy-2-(hydroxymethyl)propanoate
- 2-(2-(2-(Diethylamino)ethoxy)ethyl)-2,5-dimethyl-1,3-benzodioxole citrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethanamine, 2-[2-(2,5-dimethyl-1,3-benzodioxol-2-yl)ethoxy]-N,N-diethyl-, 2-hydroxy-1,2,3-propanetricarboxylate (1:1)
CAS:Formula:C23H35NO10Molecular weight:485.5247
