CymitQuimica logo

CAS 100318-71-6

:

N-[4-(PIPERAZINE-1-SULFONYL)-PHENYL]-ACETAMIDE

Description:
N-[4-(Piperazine-1-sulfonyl)-phenyl]-acetamide, with the CAS number 100318-71-6, is a chemical compound characterized by its piperazine moiety, which is a six-membered heterocyclic amine. This compound features a sulfonamide functional group, contributing to its potential biological activity. The presence of the acetamide group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity. The structure indicates that it may interact with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its sulfonyl group can enhance the compound's pharmacokinetic properties, such as stability and bioavailability. Additionally, the piperazine ring is often associated with various pharmacological activities, including anxiolytic and antipsychotic effects. Overall, this compound's unique structural features may provide a foundation for further research into its potential therapeutic applications.
Formula:C12H17N3O3S
InChI:InChI=1S/C12H17N3O3S/c1-10(16)14-11-2-4-12(5-3-11)19(17,18)15-8-6-13-7-9-15/h2-5,13H,6-9H2,1H3,(H,14,16)
InChI key:HMBMCJNYWPOZKR-UHFFFAOYSA-N
SMILES:CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N2CCNCC2
Found 1 products.