CAS 10032-00-5
:Geranyl acetoacetate
Description:
Geranyl acetoacetate is an organic compound characterized by its structure, which includes a geranyl group and an acetoacetate moiety. It is typically a colorless to pale yellow liquid with a pleasant floral aroma, making it valuable in the fragrance and flavor industries. The compound is known for its reactivity, particularly in condensation reactions, which can lead to the formation of various derivatives. Geranyl acetoacetate is soluble in organic solvents but has limited solubility in water. Its molecular structure contributes to its potential applications in organic synthesis, particularly in the production of more complex molecules. Additionally, it may exhibit biological activity, which has drawn interest in the fields of medicinal chemistry and natural product research. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose risks if ingested or if it comes into contact with skin. Overall, geranyl acetoacetate is a versatile compound with applications in both industrial and research settings.
Formula:C14H22O3
InChI:InChI=1S/C14H22O3/c1-11(2)6-5-7-12(3)8-9-17-14(16)10-13(4)15/h6,8H,5,7,9-10H2,1-4H3/b12-8+
InChI key:InChIKey=RYILZWKGLGVPOC-XYOKQWHBSA-N
SMILES:O(C(CC(C)=O)=O)C/C=C(/CCC=C(C)C)\C
Synonyms:- Butanoic acid, 3-oxo-, (2E)-3,7-dimethyl-2,6-octadienyl ester
- Butanoic acid, 3-oxo-, (2E)-3,7-dimethyl-2,6-octadien-1-yl ester
- Butanoic acid, 3-oxo-, 3,7-dimethyl-2,6-octadienyl ester, (E)-
- Acetoacetic acid, 3,7-dimethyl-2,6-octadienyl ester, (E)-
- Geranyl acetoacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
