CAS 1003218-25-4

1-Ethoxy-2,3-difluoro-4-(4-propyl-1-cyclohexen-1-yl)benzene

Description:

1-Ethoxy-2,3-difluoro-4-(4-propyl-1-cyclohexen-1-yl)benzene is an organic compound characterized by its complex structure, which includes a benzene ring substituted with an ethoxy group, two fluorine atoms, and a propyl-cyclohexene moiety. The presence of the ethoxy group enhances its solubility in organic solvents, while the difluoro substitutions can influence its reactivity and polarity, potentially affecting its interactions in various chemical environments. The cyclohexene ring contributes to the compound's overall stability and may impart unique stereochemical properties. This compound may be of interest in fields such as medicinal chemistry or materials science due to its potential applications in drug development or as a building block in organic synthesis. Its specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular interactions and the presence of functional groups. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₇H₂₂F₂O

InChI: InChI=1S/C17H22F2O/c1-3-5-12-6-8-13(9-7-12)14-10-11-15(20-4-2)17(19)16(14)18/h8,10-12H,3-7,9H2,1-2H3

InChI key: InChIKey=DEBVZLWMYMCVJC-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(OCC)=C1F)C=2CCC(CCC)CC2

Synonyms:

• 3-ChB(2F,3F)-O2
• 1-Ethoxy-2,3-difluoro-4-(4-propyl-1-cyclohexen-1-yl)benzene
• 3LWO2
• LY-3-O2
• Benzene, 1-ethoxy-2,3-difluoro-4-(4-propyl-1-cyclohexen-1-yl)-