CAS 10034-20-5: β-D-Glucopyranose, 2-amino-2-deoxy-, 1,3,4,6-tetraacetate, hydrochloride (1:1)
Description:β-D-Glucopyranose, 2-amino-2-deoxy-, 1,3,4,6-tetraacetate, hydrochloride (1:1) is a derivative of glucosamine, characterized by the presence of an amino group and multiple acetyl groups attached to the glucopyranose structure. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt, which enhances its solubility. The acetylation of the hydroxyl groups on the glucopyranose ring contributes to its stability and alters its reactivity, making it useful in various biochemical applications. It is often employed in carbohydrate chemistry and biochemistry for the synthesis of glycosides and as a building block in the preparation of more complex molecules. The presence of the amino group allows for further functionalization, making it a versatile intermediate in organic synthesis. As with many carbohydrate derivatives, it may exhibit biological activity, although specific biological properties would depend on the context of its use and the conditions under which it is studied.
Formula:C14H21NO9·ClH
InChI:InChI=1S/C14H21NO9.ClH/c1-6(16)20-5-10-12(21-7(2)17)13(22-8(3)18)11(15)14(24-10)23-9(4)19;/h10-14H,5,15H2,1-4H3;1H/t10-,11-,12-,13-,14-;/m1./s1
InChI key:InChIKey=BQLUYAHMYOLHBX-XAWYEFCRSA-N
SMILES:Cl.O=C(OCC1OC(OC(=O)C)C(N)C(OC(=O)C)C1OC(=O)C)C
- Synonyms:
- 1,3,4,6-Tetra-O-acetyl-2-amino--D-glucopyranose, Hydrochloride
- 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-β-<span class="text-smallcaps">D</span>-glucopyranose hydrochloride
- 1,3,4,6-Tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-glucosamine hydrochloride
- 1,3,4,6-tetra-O-acetyl-2-amino-2-deoxy-beta-D-glucopyranose hydrochloride (1:1)
- 2-Amino-2-deoxy-1,3,4,6-tetra-O-acetyl-β,<span class="text-smallcaps">D</span>-glucopyranose hydrochloride
- Glucopyranose, 2-amino-2-deoxy-, 1,3,4,6-tetraacetate, hydrochloride, β-<span class="text-smallcaps">D</span>-
- Nsc 82044
- β-<span class="text-smallcaps">D</span>-Glucopyranose, 2-amino-2-deoxy-, 1,3,4,6-tetraacetate, hydrochloride
- β-<span class="text-smallcaps">D</span>-Glucopyranose, 2-amino-2-deoxy-, 1,3,4,6-tetraacetate, hydrochloride (1:1)
- 2-Amino-2-deoxy-1,3,4,6-tetra-O-acetyl-β,D-glucopyranose hydrochloride
- See more synonyms
- Glucopyranose, 2-amino-2-deoxy-, 1,3,4,6-tetraacetate, hydrochloride, β-D-
- β-D-Glucopyranose, 2-amino-2-deoxy-, 1,3,4,6-tetraacetate, hydrochloride
- β-D-Glucopyranose, 2-amino-2-deoxy-, 1,3,4,6-tetraacetate, hydrochloride (1:1)
