CAS 100342-31-2

N-(1,1-Dimethylethyl)-5-(trimethylsilyl)-2-thiophenesulfonamide

Description:

N-(1,1-Dimethylethyl)-5-(trimethylsilyl)-2-thiophenesulfonamide is a chemical compound characterized by its unique structure, which includes a thiophene ring, a sulfonamide group, and a trimethylsilyl substituent. The presence of the thiophene moiety imparts aromatic properties, while the sulfonamide group contributes to its potential as a functionalized compound in various chemical reactions. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in synthetic applications. Additionally, the tert-butyl substituent (1,1-dimethylethyl) provides steric hindrance, which can influence the reactivity and selectivity of the compound in chemical processes. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in the development of novel materials. Its specific applications would depend on further studies exploring its reactivity and interactions with other chemical entities. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with its use.

Formula: C₁₁H₂₁NO₂S₂Si

InChI: InChI=1S/C11H21NO2S2Si/c1-11(2,3)12-16(13,14)9-7-8-10(15-9)17(4,5)6/h7-8,12H,1-6H3

InChI key: InChIKey=LXERSYGAHLSYPM-UHFFFAOYSA-N

SMILES: S(NC(C)(C)C)(=O)(=O)C=1SC([Si](C)(C)C)=CC1

Synonyms:

• N-(1,1-Dimethylethyl)-5-(trimethylsilyl)-2-thiophenesulfonamide
• 2-Thiophenesulfonamide, N-(1,1-dimethylethyl)-5-(trimethylsilyl)-

2-Thiophenesulfonamide, N-(1,1-dimethylethyl)-5-(trimethylsilyl)-

CAS: 100342-31-2

Formula: C₁₁H₂₁NO₂S₂Si

Molecular weight: 291.5054

Ref: IN-DA0001OO