CAS 100343-09-7
:3'-deoxy-3'-fluorokanamycin A
Description:
3'-Deoxy-3'-fluorokanamycin A is a synthetic derivative of kanamycin, an aminoglycoside antibiotic. This compound is characterized by the substitution of a fluorine atom at the 3' position of the deoxysugar moiety, which alters its biological activity and pharmacological properties compared to its parent compound. The presence of the fluorine atom enhances its stability and may improve its efficacy against certain bacterial strains, particularly those resistant to traditional aminoglycosides. Like other aminoglycosides, 3'-deoxy-3'-fluorokanamycin A functions by binding to the bacterial ribosome, inhibiting protein synthesis, and ultimately leading to bacterial cell death. Its structure includes multiple hydroxyl groups, contributing to its solubility in water and its interaction with biological systems. The compound has been studied for its potential therapeutic applications, particularly in treating infections caused by Gram-negative bacteria. However, as with many antibiotics, the emergence of resistance remains a significant concern in its clinical use.
Formula:C18H35FN4O10
InChI:InChI=1/C18H35FN4O10/c19-8-10(25)6(2-20)30-17(12(8)27)32-15-4(21)1-5(22)16(14(15)29)33-18-13(28)9(23)11(26)7(3-24)31-18/h4-18,24-29H,1-3,20-23H2
SMILES:C1C(C(C(C(C1N)OC1C(C(C(C(CO)O1)O)N)O)O)OC1C(C(C(C(CN)O1)O)F)O)N
Synonyms:- D-Streptamine, O-3-amino-3-deoxy-alpha-D-glucopyranosyl-(1-6)-O-(6-amino-3,6-dideoxy-3-fluoro-alpha-D-glucopyranosyl-(1-4))-2-deoxy-
- 4,6-Diamino-3-[(6-Amino-3,6-Dideoxy-3-Fluorohexopyranosyl)Oxy]-2-Hydroxycyclohexyl 3-Amino-3-Deoxyhexopyranoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.