CAS 100343-10-0

3'-deoxy-3'-fluorokanamycin B

Description:

3'-Deoxy-3'-fluorokanamycin B is a synthetic derivative of kanamycin, an aminoglycoside antibiotic. This compound is characterized by the substitution of a fluorine atom at the 3' position of the deoxysugar moiety, which alters its biological activity and pharmacological properties. The presence of the fluorine atom can enhance the compound's stability and may improve its efficacy against certain bacterial strains. Like other aminoglycosides, 3'-deoxy-3'-fluorokanamycin B functions by inhibiting bacterial protein synthesis, primarily targeting the 30S ribosomal subunit. Its structure includes multiple hydroxyl groups, contributing to its solubility in water and its interaction with bacterial ribosomes. The compound has been studied for its potential use in treating infections caused by resistant bacteria, making it a subject of interest in medicinal chemistry and antibiotic development. However, as with many antibiotics, the emergence of resistance remains a significant concern, necessitating ongoing research into its effectiveness and safety profile.

Formula: C₁₈H₃₆FN₅O₉

InChI: InChI=1/C18H36FN5O9/c19-8-9(23)17(30-6(2-20)11(8)26)32-15-4(21)1-5(22)16(14(15)29)33-18-13(28)10(24)12(27)7(3-25)31-18/h4-18,25-29H,1-3,20-24H2

SMILES: C1C(C(C(C(C1N)OC1C(C(C(C(CO)O1)O)N)O)O)OC1C(C(C(C(CN)O1)O)F)N)N

Synonyms:

• 4,6-Diamino-3-[(3-Amino-3-Deoxyhexopyranosyl)Oxy]-2-Hydroxycyclohexyl 2,6-Diamino-2,3,6-Trideoxy-3-Fluorohexopyranoside
• 3'-Deoxy-3'-fluorokanamycin B