CymitQuimica logo

CAS 100346-59-6

:

2-chloro-N-(2-ethoxyethyl)-N-(2-methoxyphenyl)acetamide

Description:
2-Chloro-N-(2-ethoxyethyl)-N-(2-methoxyphenyl)acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent, which contributes to its reactivity, and an acetamide moiety, indicating the presence of an amide bond. The ethoxyethyl group enhances its solubility in organic solvents, while the methoxyphenyl group may influence its biological activity and interaction with other molecules. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (aromatic) and hydrophilic (ethoxy and amide) components. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such characteristics are often desirable. Additionally, the presence of chlorine may impart specific properties such as increased lipophilicity or altered metabolic stability. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential toxicity associated with halogenated compounds. Overall, this compound's unique structure positions it for various applications in chemical research and development.
Formula:C13H18ClNO3
InChI:InChI=1/C13H18ClNO3/c1-3-18-9-8-15(13(16)10-14)11-6-4-5-7-12(11)17-2/h4-7H,3,8-10H2,1-2H3
Synonyms:
  • 2-Chloro-N-(2-ethoxyethyl)-N-(2-methoxyphenyl)acetamide
  • Acetamide, 2-chloro-N-(2-ethoxyethyl)-N-(2-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.