CymitQuimica logo

CAS 10035-38-8

:

5-Formyl-2-benzofurancarboxylic acid

Description:
5-Formyl-2-benzofurancarboxylic acid is an organic compound characterized by its unique structure, which includes a benzofuran moiety with both formyl and carboxylic acid functional groups. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure contributes to its reactivity, particularly in condensation reactions and as a potential building block in organic synthesis. The presence of the formyl group allows for further functionalization, making it useful in the synthesis of various derivatives. Additionally, the carboxylic acid group can participate in acid-base reactions, influencing its behavior in different chemical environments. This compound may also exhibit biological activity, although specific applications or effects would depend on further research. Overall, 5-Formyl-2-benzofurancarboxylic acid is of interest in both synthetic organic chemistry and potential pharmaceutical applications due to its versatile functional groups.
Formula:C10H6O4
InChI:InChI=1S/C10H6O4/c11-5-6-1-2-8-7(3-6)4-9(14-8)10(12)13/h1-5H,(H,12,13)
InChI key:InChIKey=YRNPPKSMEYNYAF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(O1)=CC=C(C=O)C2
Synonyms:
  • 5-Formyl-2-benzofurancarboxylic acid
  • 2-Benzofurancarboxylic acid, 5-formyl-
  • Coumarilic acid, 5-formyl-
Found 4 products.