CymitQuimica logo

CAS 1003564-38-2

:

7-Propyl-2,7-diazaspiro[3.5]nonane

Description:
7-Propyl-2,7-diazaspiro[3.5]nonane is a chemical compound characterized by its unique spirocyclic structure, which consists of two nitrogen atoms incorporated into a bicyclic framework. This compound features a propyl group attached to one of the nitrogen atoms, contributing to its overall hydrophobic character. The spiro structure indicates that the compound has two rings that share a single atom, which in this case is part of the nitrogen-containing framework. The presence of nitrogen atoms in the structure can influence its reactivity and potential biological activity, making it of interest in medicinal chemistry and drug design. Additionally, the compound's molecular geometry and steric properties may affect its interactions with biological targets. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this type typically exhibit moderate to low solubility in water, with varying solubility in organic solvents. Overall, 7-Propyl-2,7-diazaspiro[3.5]nonane represents a class of compounds that may have potential applications in pharmaceuticals or as intermediates in organic synthesis.
Formula:C10H20N2
InChI:InChI=1S/C10H20N2/c1-2-5-12-6-3-10(4-7-12)8-11-9-10/h11H,2-9H2,1H3
InChI key:InChIKey=CZJXESDLYVZQSV-UHFFFAOYSA-N
SMILES:C(CC)N1CCC2(CC1)CNC2
Synonyms:
  • 7-Propyl-2,7-diazaspiro[3.5]nonane
  • 2,7-Diazaspiro[3.5]nonane, 7-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.