CAS 1003587-73-2

5H-Pyrido[2,3-d]azepine-2-carbonitrile, 6,7,8,9-tetrahydro-, hydrochloride (1:2)

Description:

5H-Pyrido[2,3-d]azepine-2-carbonitrile, 6,7,8,9-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its complex bicyclic structure, which includes a pyridine and azepine moiety. This compound typically appears as a hydrochloride salt, indicating it is a protonated form that enhances its solubility in water. The presence of the carbonitrile functional group suggests potential reactivity and applications in organic synthesis or medicinal chemistry. Its tetrahydro configuration implies that it is a saturated derivative, which may influence its biological activity and pharmacokinetic properties. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of the hydrochloride salt. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, making it a subject of interest in drug discovery and development. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₀H₁₁N₃·2ClH

InChI: InChI=1S/C10H11N3.2ClH/c11-7-9-2-1-8-3-5-12-6-4-10(8)13-9;;/h1-2,12H,3-6H2;2*1H

InChI key: InChIKey=HLEJHKFISMWPCL-UHFFFAOYSA-N

SMILES: C(#N)C=1N=C2C(=CC1)CCNCC2.Cl

Synonyms:

• 5H-Pyrido[2,3-d]azepine-2-carbonitrile, 6,7,8,9-tetrahydro-, hydrochloride (1:2)