CAS 1003599-68-5: Bis(phenylmethyl) P-[3-[acetyl(phenylmethoxy)amino]propyl]phosphonate

Description:Bis(phenylmethyl) P-[3-[acetyl(phenylmethoxy)amino]propyl]phosphonate, identified by its CAS number 1003599-68-5, is a phosphonate compound characterized by its complex structure, which includes a phosphorus atom bonded to two phenylmethyl groups and a propyl chain that features an acetylamino group. This compound exhibits properties typical of phosphonates, such as potential applications in agriculture as a herbicide or pesticide, and in medicinal chemistry for its ability to interact with biological systems. The presence of the acetyl and phenylmethoxy groups suggests that it may possess lipophilic characteristics, enhancing its ability to permeate biological membranes. Additionally, the compound may exhibit specific reactivity due to the phosphonate functional group, which can participate in various chemical reactions, including hydrolysis and nucleophilic substitution. Its stability, solubility, and reactivity can vary based on environmental conditions, making it a subject of interest in both synthetic and applied chemistry. Further studies would be necessary to fully elucidate its biological activity and potential applications.

Formula:C₂₆H₃₀NO₅P

InChI:InChI=1S/C26H30NO5P/c1-23(28)27(30-20-24-12-5-2-6-13-24)18-11-19-33(29,31-21-25-14-7-3-8-15-25)32-22-26-16-9-4-10-17-26/h2-10,12-17H,11,18-22H2,1H3

InChI key:InChIKey=XRFOPUVTELUIOT-UHFFFAOYSA-N

SMILES:O=C(N(OCC=1C=CC=CC1)CCCP(=O)(OCC=2C=CC=CC2)OCC=3C=CC=CC3)C

Synonyms:
Bis(phenylmethyl) P-[3-[acetyl(phenylmethoxy)amino]propyl]phosphonate
Phosphonic acid, P-[3-[acetyl(phenylmethoxy)amino]propyl]-, bis(phenylmethyl) ester