CAS 1003639-52-8

3-(6-Methyl-3-pyridinyl)-3-pyrrolidinol

Description:

3-(6-Methyl-3-pyridinyl)-3-pyrrolidinol, with the CAS number 1003639-52-8, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic amines and alcohols, making it of interest in various fields, including medicinal chemistry. The presence of the methyl group on the pyridine ring can influence its solubility and reactivity, while the hydroxyl group contributes to its potential as a hydrogen bond donor. The compound may exhibit biological activity, which can be attributed to its structural similarity to other pharmacologically active substances. Its synthesis and characterization involve standard organic chemistry techniques, and it may be studied for its potential applications in drug development or as a biochemical probe. As with many organic compounds, its stability, reactivity, and interactions with other molecules can vary based on environmental conditions such as pH and temperature.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1S/C10H14N2O/c1-8-2-3-9(6-12-8)10(13)4-5-11-7-10/h2-3,6,11,13H,4-5,7H2,1H3

InChI key: InChIKey=YIVZEGNHWPSXBZ-UHFFFAOYSA-N

SMILES: OC1(C=2C=CC(C)=NC2)CCNC1

Synonyms:

• 3-Pyrrolidinol, 3-(6-methyl-3-pyridinyl)-
• 3-(6-Methyl-3-pyridinyl)-3-pyrrolidinol