CAS 100367-49-5

5-Methyl-4-isoxazolemethanol

Description:

5-Methyl-4-isoxazolemethanol, with the CAS number 100367-49-5, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a hydroxymethyl group (-CH2OH) and a methyl group (-CH3) attached to the isoxazole ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, which is indicative of the presence of the hydroxymethyl group. The compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its reactivity can be influenced by the functional groups present, allowing for potential applications in organic synthesis and medicinal chemistry. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 5-Methyl-4-isoxazolemethanol represents a versatile structure within the realm of organic chemistry.

Formula: C₅H₇NO₂

InChI: InChI=1S/C5H7NO2/c1-4-5(3-7)2-6-8-4/h2,7H,3H2,1H3

InChI key: InChIKey=NRKINZVWZUPBPP-UHFFFAOYSA-N

SMILES: C(O)C1=C(C)ON=C1

Synonyms:

• 5-Methyl-4-isoxazolemethanol
• (5-Methylisoxazol-4-yl)methanol
• (5-Methyl-isoxazol-4-yl)-methanol
• 4-Isoxazolemethanol, 5-methyl-

4-Isoxazolemethanol, 5-methyl-

CAS: 100367-49-5

Formula: C₅H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 113.1146

Ref: IN-DA0001QR

(5-Methylisoxazol-4-yl)methanol

CAS: 100367-49-5

Formula: C₅H₇NO₂

Purity: 95.0%

Molecular weight: 113.116

Ref: 10-F458099