CAS 100367-75-7

Pyridine, 2-bromo-6-methyl-, 1-oxide, hydrochloride (1:1)

Description:

Pyridine, 2-bromo-6-methyl-, 1-oxide, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 2-position and a methyl group at the 6-position contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a stable, ionic form, which enhances its solubility in polar solvents like water. This compound may exhibit biological activity, making it of interest in medicinal chemistry and organic synthesis. Its oxidation state, indicated by the "1-oxide" designation, suggests the presence of an oxygen atom bonded to the nitrogen, which can influence its electronic properties and reactivity. The compound's characteristics, including its melting point, boiling point, and spectral properties, can vary based on the specific conditions and purity. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₆H₆BrNO·ClH

InChI: InChI=1S/C6H6BrNO.ClH/c1-5-3-2-4-6(7)8(5)9;/h2-4H,1H3;1H

InChI key: InChIKey=ZTLUSTLLGBXOGZ-UHFFFAOYSA-N

SMILES: O=N=1C(Br)=CC=CC1C.Cl

Synonyms:

• 2-Picoline, 6-bromo-, 1-oxide, hydrochloride
• 2-Bromo-6-methylpyridine 1-oxide hydrochloride
• Pyridine, 2-bromo-6-methyl-, 1-oxide, hydrochloride (1:1)

Pyridine, 2-bromo-6-methyl-, 1-oxide, hydrochloride (1:1)

CAS: 100367-75-7

Formula: C₆H₇BrClNO

Molecular weight: 224.4829

Ref: IN-DA0001QK