CAS 100367-83-7
:(3-METHYL-ISOXAZOL-4-YL)-METHANOL
Description:
(3-Methyl-isoxazol-4-yl)-methanol, with the CAS number 100367-83-7, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a methyl group at the 3-position of the isoxazole ring contributes to its unique properties, while the methanol moiety indicates the presence of a hydroxyl (-OH) group, which can influence its solubility and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may exhibit polar characteristics due to the hydroxyl group, making it soluble in polar solvents like water and alcohols. The compound's potential applications could span various fields, including pharmaceuticals and agrochemicals, where isoxazole derivatives are often explored for their biological activities. However, specific biological activities, toxicity, and environmental impact would require further investigation to fully understand its practical implications.
Formula:C5H7NO2
InChI:InChI=1/C5H7NO2/c1-4-5(2-7)3-8-6-4/h3,7H,2H2,1H3
SMILES:Cc1c(CO)con1
Synonyms:- (3-Methyl-1,2-Oxazol-4-Yl)Methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
