
CAS 100369-82-2
:1-Methylethyl β-aminobenzenepropanoate
Description:
1-Methylethyl β-aminobenzenepropanoate, also known by its CAS number 100369-82-2, is an organic compound that features a β-aminobenzenepropanoate structure. This compound typically exhibits characteristics common to esters and amines, including moderate solubility in organic solvents and potential reactivity with acids and bases. The presence of the β-amino group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Its aromatic ring contributes to the compound's stability and may influence its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the methylethyl group can affect its steric hindrance and overall reactivity. As with many organic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, 1-Methylethyl β-aminobenzenepropanoate represents a unique structure that may have diverse applications in synthetic chemistry and material science.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c1-9(2)15-12(14)8-11(13)10-6-4-3-5-7-10/h3-7,9,11H,8,13H2,1-2H3
InChI key:InChIKey=VJZAAPSRRTVRQL-UHFFFAOYSA-N
SMILES:C(CC(OC(C)C)=O)(N)C1=CC=CC=C1
Synonyms:- Benzenepropanoic acid, β-amino-, 1-methylethyl ester
- Hydrocinnamic acid, β-amino-, isopropyl ester
- 1-Methylethyl β-aminobenzenepropanoate
- Isopropyl 3-amino-3-phenylpropionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
