CAS 1003708-58-4

2-Nitro-5-(trifluoromethoxy)benzonitrile

Description:

2-Nitro-5-(trifluoromethoxy)benzonitrile is an organic compound characterized by its aromatic structure, which includes a nitro group and a trifluoromethoxy substituent on a benzonitrile framework. The presence of the nitro group (-NO2) typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and polarity. The trifluoromethoxy group (-OCF3) enhances the compound's lipophilicity and can affect its solubility in various solvents. This compound is likely to exhibit properties typical of nitriles, such as high boiling points and moderate to low volatility. It may also participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of its substituents. Additionally, the trifluoromethoxy group can contribute to unique interactions in biological systems, making this compound of interest in medicinal chemistry and material science. Safety data should be consulted for handling, as compounds with nitro and trifluoromethyl functionalities can pose health and environmental risks.

Formula: C₈H₃F₃N₂O₃

InChI: InChI=1S/C8H3F3N2O3/c9-8(10,11)16-6-1-2-7(13(14)15)5(3-6)4-12/h1-3H

SMILES: c1cc(c(cc1OC(F)(F)F)C#N)N(=O)=O

Synonyms:

• 2-NITRO-5-(TRIFLUOROMETHOXY)BENZONITRILE
• Benzonitrile, 2-nitro-5-(trifluoromethoxy)-

2-Nitro-5-(trifluoromethoxy)benzonitrile

CAS: 1003708-58-4

Formula: C₈H₃F₃N₂O₃

Molecular weight: 232.1162

Ref: IN-DA0001R0

2-Nitro-5-(trifluoromethoxy)benzonitrile

CAS: 1003708-58-4

2-Nitro-5-(trifluoromethoxy)benzonitrile

Purity: ≥95%

Molecular weight: 232.12g/mol

Ref: 54-PC502663