CAS 1003709-57-6

3-Fluoro-4-iodobenzaldehyde

Description:

3-Fluoro-4-iodobenzaldehyde is an organic compound characterized by the presence of both fluorine and iodine substituents on a benzaldehyde ring. It features a benzene ring with a formyl group (-CHO) and halogen atoms at the 3 and 4 positions, respectively. This compound is typically a pale yellow to light brown solid at room temperature and is known for its reactivity due to the presence of the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The fluorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity, while the iodine atom may facilitate certain coupling reactions in synthetic applications. 3-Fluoro-4-iodobenzaldehyde is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its unique structural features that allow for further functionalization. Proper handling and storage are essential, as with many halogenated compounds, to ensure safety and stability.

Formula: C₇H₄FIO

InChI: InChI=1S/C7H4FIO/c8-6-3-5(4-10)1-2-7(6)9/h1-4H

SMILES: c1cc(c(cc1C=O)F)I

Synonyms:

• 3-Fluoro-4-iodo-benzaldehyde
• Benzaldehyde, 3-fluoro-4-iodo-

Benzaldehyde, 3-fluoro-4-iodo-

CAS: 1003709-57-6

Formula: C₇H₄FIO

Purity: 97%

Color and Shape: Solid

Molecular weight: 250.0089

Ref: IN-DA0001RY

3-Fluoro-4-iodobenzaldehyde

CAS: 1003709-57-6

3-Fluoro-4-iodobenzaldehyde

Formula: C₇H₄FIO

Purity: ≥95%

Color and Shape: light orange crystalline powder

Molecular weight: 250.01g/mol

Ref: 54-PC49375

3-Fluoro-4-iodobenzaldehyde

CAS: 1003709-57-6

Formula: C₇H₄FIO

Purity: 97%

Color and Shape: Solid

Molecular weight: 250.011

Ref: 10-F211993