CAS 1003710-06-2

3,5-difluoro-2-methylbenzoic acid

Description:

3,5-Difluoro-2-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methyl group on a benzoic acid framework. The fluorine substituents are located at the 3 and 5 positions relative to the carboxylic acid group, while the methyl group is positioned at the 2 position. This compound exhibits typical properties of benzoic acids, including the ability to form hydrogen bonds due to the carboxylic acid functional group, which contributes to its solubility in polar solvents. The presence of fluorine atoms enhances its lipophilicity and may influence its reactivity and interaction with biological systems. Additionally, the compound's molecular structure can lead to unique electronic properties, potentially affecting its behavior in chemical reactions and applications in pharmaceuticals or agrochemicals. Its specific melting point, boiling point, and other physical properties would need to be referenced from experimental data or literature for precise applications.

Formula: C₈H₆F₂O₂

InChI: InChI=1S/C8H6F2O2/c1-4-6(8(11)12)2-5(9)3-7(4)10/h2-3H,1H3,(H,11,12)

SMILES: Cc1c(cc(cc1F)F)C(=O)O

Synonyms:

• Benzoic acid, 3,5-difluoro-2-methyl-

Benzoic acid, 3,5-difluoro-2-methyl-

CAS: 1003710-06-2

Formula: C₈H₆F₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.1288

Ref: IN-DA0001RS

3,5-Difluoro-2-methylbenzoic acid

CAS: 1003710-06-2

3,5-Difluoro-2-methylbenzoic acid

Formula: C₈H₆F₂O₂

Purity: 98%

Color and Shape: solid

Molecular weight: 172.13g/mol

Ref: 54-PC302272

3,5-Difluoro-2-methylbenzoic acid

CAS: 1003710-06-2

Formula: C₈H₆F₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.131

Ref: 10-F037162