CymitQuimica logo

CAS 1003710-53-9

:

2-Amino-4-bromo-5-chloro-3-pyridinol

Description:
2-Amino-4-bromo-5-chloro-3-pyridinol is a heterocyclic organic compound characterized by its pyridine ring, which contains both amino and halogen substituents. The presence of the amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications in pharmaceuticals. The bromine and chlorine atoms introduce significant electronegativity and steric effects, influencing the compound's reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. Its unique structure allows it to participate in nucleophilic substitution reactions, making it valuable in synthetic organic chemistry. Additionally, the compound may have biological activity, which could be explored for potential therapeutic applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 2-Amino-4-bromo-5-chloro-3-pyridinol is an interesting compound with diverse chemical properties and potential applications.
Formula:C5H4BrClN2O
InChI:InChI=1S/C5H4BrClN2O/c6-3-2(7)1-9-5(8)4(3)10/h1,10H,(H2,8,9)
InChI key:InChIKey=GYYGRGYDRYQMQD-UHFFFAOYSA-N
SMILES:BrC=1C(O)=C(N)N=CC1Cl
Synonyms:
  • 3-Pyridinol, 2-amino-4-bromo-5-chloro-
  • 2-Amino-4-bromo-5-chloro-3-pyridinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.