CymitQuimica logo

CAS 1003710-95-9

:

2-Amino-5-chloro-4-methyl-3-pyridinol

Description:
2-Amino-5-chloro-4-methyl-3-pyridinol is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a chloro substituent (-Cl) at specific positions on the pyridine ring, along with a methyl group (-CH3). The presence of these functional groups contributes to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the amino group. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a precursor or intermediate in the synthesis of pharmaceuticals. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted to understand its handling and potential hazards, as halogenated compounds can pose risks in terms of toxicity and environmental impact.
Formula:C6H7ClN2O
InChI:InChI=1S/C6H7ClN2O/c1-3-4(7)2-9-6(8)5(3)10/h2,10H,1H3,(H2,8,9)
InChI key:InChIKey=UWGKKEXWMSXTTI-UHFFFAOYSA-N
SMILES:CC=1C(O)=C(N)N=CC1Cl
Synonyms:
  • 2-Amino-5-chloro-4-methyl-3-pyridinol
  • 3-Pyridinol, 2-amino-5-chloro-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.