
CAS 1003711-61-2
:3-Bromo-2-fluoro-4-iodo-6-methylpyridine
Description:
3-Bromo-2-fluoro-4-iodo-6-methylpyridine is a halogenated pyridine derivative characterized by the presence of three halogen substituents (bromo, fluoro, and iodo) and a methyl group on the pyridine ring. This compound features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The presence of multiple halogens can significantly influence its chemical properties, including reactivity, polarity, and solubility. Typically, such compounds exhibit interesting biological activities and can serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. The specific arrangement of substituents affects the electronic distribution within the molecule, potentially enhancing its reactivity in nucleophilic or electrophilic substitution reactions. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the steric and electronic effects of the halogen atoms and the methyl group. Overall, 3-Bromo-2-fluoro-4-iodo-6-methylpyridine is a valuable compound in synthetic organic chemistry and medicinal chemistry research.
Formula:C6H4BrFIN
InChI:InChI=1S/C6H4BrFIN/c1-3-2-4(9)5(7)6(8)10-3/h2H,1H3
InChI key:InChIKey=GWPQARXMLSBVJD-UHFFFAOYSA-N
SMILES:BrC=1C(I)=CC(C)=NC1F
Synonyms:- 3-Bromo-2-fluoro-4-iodo-6-methylpyridine
- Pyridine, 3-bromo-2-fluoro-4-iodo-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
