CAS 1003711-72-5

3-Methyl-2-(methylsulfonyl)pyridine

Description:

3-Methyl-2-(methylsulfonyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methyl group at the 3-position and a methylsulfonyl group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar organic solvents, which is common for compounds containing sulfonyl groups. The methylsulfonyl moiety enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and as a potential building block in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability under standard conditions allows for handling and storage, but it should be managed with appropriate safety precautions due to potential toxicity associated with sulfonyl compounds.

Formula: C₇H₉NO₂S

InChI: InChI=1S/C7H9NO2S/c1-6-4-3-5-8-7(6)11(2,9)10/h3-5H,1-2H3

InChI key: InChIKey=VYHONYCTCCUKDU-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=C(C)C=CC=N1

Synonyms:

• 3-Methyl-2-(methylsulfonyl)pyridine
• Pyridine, 3-methyl-2-(methylsulfonyl)-