
CAS 1003711-88-3
:4-Iodo-2-nitropyridine
Description:
4-Iodo-2-nitropyridine is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a pyridine ring. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and reactivity. The iodine substituent typically enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The nitro group, known for its electron-withdrawing effects, can influence the compound's reactivity and stability, often making it a target for reduction reactions. This compound is generally soluble in organic solvents and may exhibit moderate stability under standard conditions. Its unique combination of functional groups allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Safety considerations should be taken into account due to the presence of iodine and nitro groups, which can pose health hazards. Overall, 4-Iodo-2-nitropyridine serves as a valuable intermediate in synthetic organic chemistry.
Formula:C5H3IN2O2
InChI:InChI=1S/C5H3IN2O2/c6-4-1-2-7-5(3-4)8(9)10/h1-3H
InChI key:InChIKey=PXUUFQDUIYMEGH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(I)=CC=N1
Synonyms:- 4-Iodo-2-nitropyridine
- Pyridine, 4-iodo-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.