CymitQuimica logo

CAS 1003712-20-6

:

2,5-Difluoro-3-Methylbenzonitrile

Description:
2,5-Difluoro-3-methylbenzonitrile is an aromatic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and a methyl group, along with a nitrile functional group. The fluorine atoms are located at the 2 and 5 positions of the benzene ring, while the methyl group is at the 3 position, contributing to the compound's unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its relatively high stability due to the aromatic nature of the benzene ring, and the presence of fluorine can enhance its lipophilicity and influence its interaction with biological systems. 2,5-Difluoro-3-methylbenzonitrile may be utilized in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested.
Formula:C8H5F2N
InChI:InChI=1S/C8H5F2N/c1-5-2-7(9)3-6(4-11)8(5)10/h2-3H,1H3
InChI key:GOCHUEANXRBERE-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1F)C#N)F
Found 5 products.