CymitQuimica logo

CAS 100372-35-8

:

3-benzyl-1-ethylpyrrolidine-2,5-dione

Description:
3-Benzyl-1-ethylpyrrolidine-2,5-dione, with the CAS number 100372-35-8, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups within the pyrrolidine framework. The benzyl group attached to the third carbon of the ring contributes to its aromatic characteristics, while the ethyl group at the first position enhances its hydrophobic properties. The presence of these substituents can influence the compound's reactivity, solubility, and potential biological activity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the molecular structure suggests potential for various chemical reactions, including nucleophilic additions and cycloadditions, due to the electrophilic nature of the carbonyl groups. Overall, 3-benzyl-1-ethylpyrrolidine-2,5-dione is a compound with unique structural features that may have implications in both synthetic and medicinal chemistry.
Formula:C13H15NO2
InChI:InChI=1/C13H15NO2/c1-2-14-12(15)9-11(13(14)16)8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.