CymitQuimica logo

CAS 100374-81-0

:

4-Bromo-N-(4-chlorophenyl)-N-methylbenzenesulfonamide

Description:
4-Bromo-N-(4-chlorophenyl)-N-methylbenzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a bromine atom and a chlorophenyl group, contributing to its unique reactivity and potential biological activity. The presence of the sulfonamide moiety suggests that it may interact with biological systems, possibly inhibiting certain enzymes or pathways. Its molecular structure includes a benzene ring, which enhances its stability and lipophilicity, allowing for better membrane permeability. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Due to the presence of halogen substituents, it may also display interesting electronic properties, influencing its reactivity in various chemical reactions. As with many sulfonamides, it may have applications in pharmaceuticals, particularly in the development of antimicrobial agents. However, safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C13H11BrClNO2S
InChI:InChI=1S/C13H11BrClNO2S/c1-16(12-6-4-11(15)5-7-12)19(17,18)13-8-2-10(14)3-9-13/h2-9H,1H3
InChI key:InChIKey=RADMIBNHYAUTFV-UHFFFAOYSA-N
SMILES:S(N(C)C1=CC=C(Cl)C=C1)(=O)(=O)C2=CC=C(Br)C=C2
Synonyms:
  • Benzenesulfonamide, 4-bromo-N-(4-chlorophenyl)-N-methyl-
  • 4-Bromo-N-(4-chlorophenyl)-N-methylbenzenesulfonamide
  • Benzenesulfonanilide, 4-bromo-4′-chloro-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.