CAS 100377-16-0

N-(2-Cyano-1-cyclopenten-1-yl)-acetamide

Description:

N-(2-Cyano-1-cyclopenten-1-yl)-acetamide, with the CAS number 100377-16-0, is an organic compound characterized by its unique structural features, including a cyano group and a cyclopentene ring. This compound typically exhibits a polar nature due to the presence of the cyano and acetamide functional groups, which can influence its solubility in various solvents. It may participate in hydrogen bonding due to the amide functionality, affecting its reactivity and interaction with other molecules. The presence of the cyclopentene moiety suggests potential for undergoing various chemical reactions, such as cycloaddition or substitution, making it of interest in synthetic organic chemistry. Additionally, the cyano group can serve as a versatile handle for further functionalization. While specific physical properties such as melting point, boiling point, and spectral data are not provided here, compounds of this nature are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis.

Formula: C₈H₁₀N₂O

InChI: InChI=1/C8H10N2O/c1-6(11)10-8-4-2-3-7(8)5-9/h2-4H2,1H3,(H,10,11)

SMILES: CC(=NC1=C(CCC1)C#N)O

Synonyms:

• Acetamide, N-(2-cyano-1-cyclopenten-1-yl)- (6CI, 9CI)
• 1-acetamide-2-Cyano-1-Cyclopentene
• N-(2-cyanocyclopent-1-en-1-yl)acetamide

N-(2-Cyano-1-cyclopenten-1-yl)-acetamide

CAS: 100377-16-0

Formula: C₈H₁₀N₂O

Molecular weight: 150.1778

Ref: IN-DA0001TG

N-(2-Cyano-1-cyclopenten-1-yl)-acetamide

CAS: 100377-16-0

N-(2-Cyano-1-cyclopenten-1-yl)-acetamide

Purity: 95%

Molecular weight: 150.18g/mol

Ref: 54-OR930447