CAS 100377-22-8: 2-[(4-Aminophenyl)thio]acetamide

Description:2-[(4-Aminophenyl)thio]acetamide, with the CAS number 100377-22-8, is an organic compound characterized by the presence of both an amine and a thioether functional group. It features a thioether linkage between a 4-aminophenyl group and an acetamide moiety, which contributes to its potential biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide functional group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with amino and thioether functionalities often demonstrate interesting biological properties. Additionally, the presence of the amino group may allow for further derivatization, enhancing its utility in various chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula:C₈H₁₀N₂OS

InChI:InChI=1S/C8H10N2OS/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H2,10,11)

InChI key:InChIKey=GYRKBGAALJLBNX-UHFFFAOYSA-N

SMILES:O=C(N)CSC1=CC=C(N)C=C1

Synonyms:
2-[(4-Aminophenyl)thio]acetamide
Acetamide, 2-[(4-aminophenyl)thio]-
2-(4-Aminophenyl)sulfanylacetamide
(4-Amino-phenylsulfanyl)-acetic acid amide
Acetamide, 2-(p-aminophenylthio)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-((4-Aminophenyl)thio)acetamide REF: 10-F735714CAS: 100377-22-8	95%	- - -	Discontinued product
	2-[(4-Aminophenyl)thio]acetamide REF: 3D-AEA37722CAS: 100377-22-8	Min. 95%	- - -	Discontinued product