CAS 100377-63-7
:Vanillic acid hydrazide
Description:
Vanillic acid hydrazide is an organic compound characterized by its hydrazide functional group attached to vanillic acid, which is derived from vanillin. This compound typically appears as a white to off-white crystalline solid. It is known for its potential applications in pharmaceuticals and as a reagent in organic synthesis. The presence of both the hydrazide and the aromatic vanillic acid structure contributes to its reactivity, making it useful in various chemical reactions, including condensation and coupling reactions. Vanillic acid hydrazide may exhibit biological activity, which has led to research into its potential therapeutic properties. Additionally, it is soluble in polar solvents, which facilitates its use in various chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, vanillic acid hydrazide is a compound of interest in both synthetic chemistry and potential medicinal applications.
Formula:C8H10N2O3
InChI:InChI=1/C8H10N2O3/c1-13-7-4-5(8(12)10-9)2-3-6(7)11/h2-4,11H,9H2,1H3,(H,10,12)
InChI key:AWVJTGNFMZKXDN-UHFFFAOYSA-N
SMILES:COc1cc(ccc1O)C(=NN)O
Synonyms:- 4-Hydroxy-3-methoxybenzhydrazide
- 4-Hydroxy-3-Methoxybenzohydrazide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Hydroxy-3-Methoxybenzohydrazide
CAS:4-Hydroxy-3-MethoxybenzohydrazideFormula:C8H10N2O3Purity:98%Molecular weight:182.184-Hydroxy-3-methoxybenzohydrazide
CAS:Formula:C8H10N2O3Purity:%Color and Shape:SolidMolecular weight:182.1766Vanillic acid hydrazide
CAS:Vanillic acid hydrazide is a multinuclear compound with condensation products. It has been shown to have antibacterial, anticancer and skeleton-related properties. Vanillic acid hydrazide is able to bind to the 4-hydroxybenzoic acid and introduce it into the cell in order to inhibit the synthesis of fatty acids. This compound also inhibits the growth of cancer cells by preventing their proliferation and proliferation by binding to DNA. Vanillic acid hydrazide may also bind to fatty acids on cell membranes, which would lead to a decrease in membrane fluidity and increase in membrane permeability, leading to cell death.
Formula:C8H10N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:182.18 g/mol




