CAS 1003845-08-6
:2-Chloropyrimidine-5-boronic acid pinacol ester
Description:
2-Chloropyrimidine-5-boronic acid pinacol ester is an organoboron compound characterized by the presence of a pyrimidine ring substituted with a chlorine atom and a boronic acid moiety that is esterified with pinacol. This compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water. The boronic acid functionality allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. The chlorine substituent on the pyrimidine ring can serve as a leaving group in nucleophilic substitution reactions. Additionally, the pinacol ester provides stability to the boronic acid group, enhancing its utility in various chemical transformations. Overall, this compound is significant in medicinal chemistry and materials science due to its reactivity and ability to form complex molecular architectures. Safety precautions should be observed when handling this compound, as with many organoboron derivatives, due to potential toxicity and reactivity.
Formula:C10H14BClN2O2
InChI:InChI=1S/C10H14BClN2O2/c1-9(2)10(3,4)16-11(15-9)7-5-13-8(12)14-6-7/h5-6H,1-4H3
SMILES:CC1(C)C(C)(C)OB(c2cnc(Cl)nc2)O1
Synonyms:- 2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine
CAS:Formula:C10H14BClN2O2Purity:>98.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:240.492-Chloropyrimidine-5-boronic acid pinacol ester, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H14BClN2O2Purity:98%Molecular weight:240.49Pyrimidine, 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
CAS:Formula:C10H14BClN2O2Purity:97%Color and Shape:SolidMolecular weight:240.49442-Chloropyrimidine-5-boronic acid, pinacol ester
CAS:<p>2-Chloropyrimidine-5-boronic acid, pinacol ester</p>Formula:C10H14BClN2O2Purity:98%Color and Shape: pale yellow solidMolecular weight:240.49g/mol2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine
CAS:Formula:C10H14BClN2O2Purity:97%Color and Shape:Solid, Yellow powderMolecular weight:240.49




