
CAS 1003858-65-8
:2-Ethynyl-5-methyl-4-nitrobenzenamine
Description:
2-Ethynyl-5-methyl-4-nitrobenzenamine is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2), an ethynyl group (-C≡CH), and an amino group (-NH2) attached to a benzene ring. The presence of the nitro group contributes to its potential as a strong electron-withdrawing group, influencing the compound's reactivity and stability. The ethynyl group introduces a triple bond, which can participate in various chemical reactions, including coupling reactions and polymerization. The methyl group provides additional steric hindrance and can affect the compound's solubility and boiling point. This compound may exhibit interesting properties such as fluorescence or photochemical activity, making it of interest in materials science and organic synthesis. Additionally, due to the presence of both the nitro and amino functional groups, it may have applications in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as compounds with nitro groups can be sensitive and potentially hazardous.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-3-7-5-9(11(12)13)6(2)4-8(7)10/h1,4-5H,10H2,2H3
InChI key:InChIKey=ROMDUBKKALNQEQ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C=C(N)C(C#C)=C1
Synonyms:- 2-Ethynyl-5-methyl-4-nitroaniline
- 2-Ethynyl-5-methyl-4-nitrobenzenamine
- Benzenamine, 2-ethynyl-5-methyl-4-nitro-
- (2-Ethynyl-5-methyl-4-nitrophenyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
