CymitQuimica logo

CAS 1003858-69-2

:

4-Fluoro-5-nitro-1H-indole

Description:
4-Fluoro-5-nitro-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 4-position and a nitro group at the 5-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with indole derivatives. The nitro group can serve as a site for further chemical modifications, while the fluorine atom can enhance lipophilicity and metabolic stability. Additionally, 4-Fluoro-5-nitro-1H-indole may exhibit interesting electronic properties, making it a subject of study in materials science and organic electronics. Safety data should be consulted for handling, as nitro compounds can be sensitive and potentially hazardous.
Formula:C8H5FN2O2
InChI:InChI=1S/C8H5FN2O2/c9-8-5-3-4-10-6(5)1-2-7(8)11(12)13/h1-4,10H
InChI key:InChIKey=UTYWHDIQWCMUNW-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC=C1N(=O)=O)NC=C2
Synonyms:
  • 4-Fluoro-5-nitro-1H-indole
  • 1H-Indole, 4-fluoro-5-nitro-
Found 4 products.