CymitQuimica logo

CAS 1003858-72-7

:

7-Chloro-4-methyl-1H-indol-5-amine

Description:
7-Chloro-4-methyl-1H-indol-5-amine, with the CAS number 1003858-72-7, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure consisting of a fused benzene and pyrrole ring. This compound features a chlorine atom at the 7-position and a methyl group at the 4-position of the indole ring, along with an amino group at the 5-position, which contributes to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit properties such as solubility in organic solvents, depending on the specific formulation and purity. The presence of the amino group suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the chlorine substituent can influence the compound's electronic properties and lipophilicity, affecting its pharmacokinetics and pharmacodynamics. Overall, 7-Chloro-4-methyl-1H-indol-5-amine is a compound of interest for further research in various chemical and biological applications.
Formula:C9H9ClN2
InChI:InChI=1S/C9H9ClN2/c1-5-6-2-3-12-9(6)7(10)4-8(5)11/h2-4,12H,11H2,1H3
InChI key:InChIKey=YAQYIOUUDQZYID-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(Cl)C=C1N)NC=C2
Synonyms:
  • 1H-Indol-5-amine, 7-chloro-4-methyl-
  • 5-Amino-7-chloro-4-methylindole
  • 7-Chloro-4-methyl-1H-indol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.