CAS 1003859-14-0
:6-Chloro-N-(2,2-difluoroethyl)-3-pyridinemethanamine
Description:
6-Chloro-N-(2,2-difluoroethyl)-3-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro substituent at the 6-position of the pyridine ring and a difluoroethyl group attached to the nitrogen atom contributes to its unique reactivity and potential applications in medicinal chemistry. This compound may exhibit properties such as moderate to high polarity due to the electronegative chlorine and fluorine atoms, which can influence its solubility in various solvents. Additionally, the difluoroethyl group may enhance lipophilicity, potentially affecting its biological activity. The compound's structure suggests it could be of interest in the development of pharmaceuticals, particularly in targeting specific biological pathways or receptors. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, influencing its interactions in biological systems. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H9ClF2N2
InChI:InChI=1S/C8H9ClF2N2/c9-7-2-1-6(4-13-7)3-12-5-8(10)11/h1-2,4,8,12H,3,5H2
InChI key:InChIKey=QDQGMLOVCICKPV-UHFFFAOYSA-N
SMILES:C(NCC(F)F)C=1C=CC(Cl)=NC1
Synonyms:- N-[(6-Chloropyridin-3-yl)methyl]-2,2-difluoroethanamine
- N-[(6-Chloropyridin-3-yl)methyl]-2,2-difluoroethylamine
- 3-Pyridinemethanamine, 6-chloro-N-(2,2-difluoroethyl)-
- 6-Chloro-N-(2,2-difluoroethyl)-3-pyridinemethanamine
- N-((6-chloropyridin-3-yl)methyl)-2,2-difluoroethan-1-amine
- N-[(6-Chloropyridin-3-yl)methyl]-2,2-difluoroethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Chloro-N-(2,2-difluoroethyl)-3-pyridinemethanamine-d2
CAS:Controlled Product<p>Applications 6-Chloro-N-(2,2-difluoroethyl)-3-pyridinemethanamine-d2 is an intermediate used in the synthesis of Flupyradifurone-d5 (F598616), which is the labeled form of Flupyradifurone (F598615), can be used as an insecticide.<br>References Anon, IP.com J., 12, 19 (2011)<br></p>Formula:C8D2H7ClF2N2Color and Shape:NeatMolecular weight:208.633
