CymitQuimica logo

CAS 1003865-65-3

:

4-(Difluoromethoxy)-2-fluoroaniline

Description:
4-(Difluoromethoxy)-2-fluoroaniline is an organic compound characterized by the presence of an aniline structure, which consists of an amino group (-NH2) attached to a benzene ring. This particular compound features a difluoromethoxy group (-O-CHF2) and a fluoro substituent on the aromatic ring, contributing to its unique chemical properties. The presence of multiple fluorine atoms enhances its lipophilicity and may influence its reactivity and interaction with biological systems. It is typically a colorless to pale yellow solid at room temperature and may exhibit moderate solubility in organic solvents. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Safety data should be consulted for handling, as fluorinated compounds can exhibit toxicity and environmental persistence. Overall, 4-(Difluoromethoxy)-2-fluoroaniline represents a valuable compound for research and industrial applications.
Formula:C7H6F3NO
InChI:InChI=1S/C7H6F3NO/c8-5-3-4(12-7(9)10)1-2-6(5)11/h1-3,7H,11H2
InChI key:SHPNHKYZRBEKGY-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1OC(F)F)F)N
Found 4 products.