
CAS 10039-39-1
:3-Furanol, 5-hexyltetrahydro-, 3-acetate
Description:
3-Furanol, 5-hexyltetrahydro-, 3-acetate, with the CAS number 10039-39-1, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a hexyl group, indicating a six-carbon alkyl chain, which contributes to its hydrophobic properties. The acetate functional group suggests that it is an ester, derived from acetic acid, which can influence its reactivity and solubility in various solvents. Typically, compounds like this may exhibit moderate volatility and can be used in flavoring or fragrance applications due to their pleasant aromatic characteristics. Additionally, the presence of the furan ring may impart specific biological activities, making it of interest in medicinal chemistry. Its physical properties, such as boiling point and melting point, would depend on the molecular interactions and the presence of functional groups. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H22O3
InChI:InChI=1S/C12H22O3/c1-3-4-5-6-7-11-8-12(9-14-11)15-10(2)13/h11-12H,3-9H2,1-2H3
InChI key:InChIKey=IAJCTZJZXRAPDK-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1CC(CCCCCC)OC1
Synonyms:- (5-Hexyloxolan-3-yl) acetate
- 2-Hexyl-4-acetoxytetrahydrofuran
- 3-Furanol, 5-hexyltetrahydro-, acetate
- 3-Furanol, 5-hexyltetrahydro-, 3-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
